ChemNet > CAS > 5019-82-9 Bicyclo[3.2.1]octan-2-one
5019-82-9 Bicyclo[3.2.1]octan-2-one
| product Name |
Bicyclo[3.2.1]octan-2-one |
| CAS No |
5019-82-9 |
| Synonyms |
bicyclo(3.2.1)octan-2-one |
| Molecular Formula |
C8H12O |
| Molecular Weight |
124.1803 |
| InChI |
InChI=1/C8H12O/c9-8-4-2-6-1-3-7(8)5-6/h6-7H,1-5H2 |
| EINECS |
225-704-7 |
| Molecular Structure |
![5019-82-9 Bicyclo[3.2.1]octan-2-one](https://images-a.chemnet.com/suppliers/chembase/354/3545.gif)
|
| Density |
1.039g/cm3 |
| Melting point |
118-124℃ |
| Boiling point |
201.6°C at 760 mmHg |
| Refractive index |
1.499 |
| Flash point |
68.7°C |
| Vapour Pressur |
0.305mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
